C29H22N3O2Pt- — CID 176605761
3-methyl-2-[[6-methyl-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum (PubChem CID 176605761) has the molecular formula C29H22N3O2Pt- and a molecular weight of 639.59 g/mol. Its IUPAC name is 3-methyl-2-[[6-methyl-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum.
| Compound Name | 3-methyl-2-[[6-methyl-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum |
|---|---|
| PubChem CID | 176605761 |
| Molecular Formula | C29H22N3O2Pt- |
| Molecular Weight | 639.59 g/mol |
| Exact Mass | 639.14 |
| IUPAC Name | 3-methyl-2-[[6-methyl-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum |
| SMILES | Cc1ccnc(-n2c3[c-]c(Oc4nc5c(O)cccc5cc4C)ccc3c3cc(C)ccc32)c1.[Pt] |
| InChI | InChI=1S/C29H22N3O2.Pt/c1-17-7-10-24-23(13-17)22-9-8-21(16-25(22)32(24)27-14-18(2)11-12-30-27)34-29-19(3)15-20-5-4-6-26(33)28(20)31-29;/h4-15,33H,1-3H3;/q-1; |
| InChIKey | UNODPZWUPZXKFH-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.59 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|