C34H30N3O2Pt- — CID 176606138
2-[[7-cyclopentyl-9-(6-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-3,6-dimethylquinolin-8-ol;platinum (PubChem CID 176606138) has the molecular formula C34H30N3O2Pt- and a molecular weight of 707.71 g/mol. Its IUPAC name is 2-[[7-cyclopentyl-9-(6-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-3,6-dimethylquinolin-8-ol;platinum.
| Compound Name | 2-[[7-cyclopentyl-9-(6-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-3,6-dimethylquinolin-8-ol;platinum |
|---|---|
| PubChem CID | 176606138 |
| Molecular Formula | C34H30N3O2Pt- |
| Molecular Weight | 707.71 g/mol |
| Exact Mass | 707.20 |
| IUPAC Name | 2-[[7-cyclopentyl-9-(6-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-3,6-dimethylquinolin-8-ol;platinum |
| SMILES | Cc1cc(O)c2nc(Oc3[c-]c4c(cc3)c3ccc(C5CCCC5)cc3n4-c3cccc(C)n3)c(C)cc2c1.[Pt] |
| InChI | InChI=1S/C34H30N3O2.Pt/c1-20-15-25-17-21(2)34(36-33(25)31(38)16-20)39-26-12-14-28-27-13-11-24(23-8-4-5-9-23)18-29(27)37(30(28)19-26)32-10-6-7-22(3)35-32;/h6-7,10-18,23,38H,4-5,8-9H2,1-3H3;/q-1; |
| InChIKey | KSZMZSJDVLMLGX-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.71 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|