C40H37N3OPt — CID 153421345
9-(4-cyclohexyl-2-pyridinyl)-2-[3-[(4-cyclohexyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153421345) has the molecular formula C40H37N3OPt and a molecular weight of 770.83 g/mol. Its IUPAC name is 9-(4-cyclohexyl-2-pyridinyl)-2-[3-[(4-cyclohexyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 9-(4-cyclohexyl-2-pyridinyl)-2-[3-[(4-cyclohexyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153421345 |
| Molecular Formula | C40H37N3OPt |
| Molecular Weight | 770.83 g/mol |
| Exact Mass | 770.26 |
| IUPAC Name | 9-(4-cyclohexyl-2-pyridinyl)-2-[3-[(4-cyclohexyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(Oc2cc(C3CCCCC3)ccn2)cccc1-c1[c-]c2c(cc1)c1ccccc1n2-c1cc(C2CCCCC2)ccn1 |
| InChI | InChI=1S/C40H37N3O.Pt/c1-3-10-28(11-4-1)32-20-22-41-39(26-32)43-37-17-8-7-16-35(37)36-19-18-31(25-38(36)43)30-14-9-15-34(24-30)44-40-27-33(21-23-42-40)29-12-5-2-6-13-29;/h7-9,14-23,26-29H,1-6,10-13H2;/q-2;+2 |
| InChIKey | KYNLJNIPAKOKQG-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.83 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|