C43H32N3O2Pt- — CID 176605949
2-[[9-(4-cyclopentyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-4,5-diphenylquinolin-8-ol;platinum (PubChem CID 176605949) has the molecular formula C43H32N3O2Pt- and a molecular weight of 817.83 g/mol. Its IUPAC name is 2-[[9-(4-cyclopentyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-4,5-diphenylquinolin-8-ol;platinum.
| Compound Name | 2-[[9-(4-cyclopentyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-4,5-diphenylquinolin-8-ol;platinum |
|---|---|
| PubChem CID | 176605949 |
| Molecular Formula | C43H32N3O2Pt- |
| Molecular Weight | 817.83 g/mol |
| Exact Mass | 817.21 |
| IUPAC Name | 2-[[9-(4-cyclopentyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-4,5-diphenylquinolin-8-ol;platinum |
| SMILES | Oc1ccc(-c2ccccc2)c2c(-c3ccccc3)cc(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc(C4CCCC4)ccn3)nc12.[Pt] |
| InChI | InChI=1S/C43H32N3O2.Pt/c47-39-22-21-33(29-13-3-1-4-14-29)42-36(30-15-5-2-6-16-30)27-41(45-43(39)42)48-32-19-20-35-34-17-9-10-18-37(34)46(38(35)26-32)40-25-31(23-24-44-40)28-11-7-8-12-28;/h1-6,9-10,13-25,27-28,47H,7-8,11-12H2;/q-1; |
| InChIKey | OYGIZQNJKPWZSQ-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.83 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|