C33H25N3O2Pt — CID 153421470
9-(4-cyclobutyl-2-pyridinyl)-2-[3-[(4-methoxy-2-pyridinyl)oxy]benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153421470) has the molecular formula C33H25N3O2Pt and a molecular weight of 690.66 g/mol. Its IUPAC name is 9-(4-cyclobutyl-2-pyridinyl)-2-[3-[(4-methoxy-2-pyridinyl)oxy]benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 9-(4-cyclobutyl-2-pyridinyl)-2-[3-[(4-methoxy-2-pyridinyl)oxy]benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153421470 |
| Molecular Formula | C33H25N3O2Pt |
| Molecular Weight | 690.66 g/mol |
| Exact Mass | 690.16 |
| IUPAC Name | 9-(4-cyclobutyl-2-pyridinyl)-2-[3-[(4-methoxy-2-pyridinyl)oxy]benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+) |
| SMILES | COc1ccnc(Oc2[c-]c(-c3[c-]c4c(cc3)c3ccccc3n4-c3cc(C4CCC4)ccn3)ccc2)c1.[Pt+2] |
| InChI | InChI=1S/C33H25N3O2.Pt/c1-37-26-15-17-35-33(21-26)38-27-9-5-8-23(18-27)24-12-13-29-28-10-2-3-11-30(28)36(31(29)19-24)32-20-25(14-16-34-32)22-6-4-7-22;/h2-3,5,8-17,20-22H,4,6-7H2,1H3;/q-2;+2 |
| InChIKey | OJLGPVSBACSSAO-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.66 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|