C44H28N3O2Pt- — CID 176606140
4,5-diphenyl-2-[[9-(4-phenyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum (PubChem CID 176606140) has the molecular formula C44H28N3O2Pt- and a molecular weight of 825.81 g/mol. Its IUPAC name is 4,5-diphenyl-2-[[9-(4-phenyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum.
| Compound Name | 4,5-diphenyl-2-[[9-(4-phenyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum |
|---|---|
| PubChem CID | 176606140 |
| Molecular Formula | C44H28N3O2Pt- |
| Molecular Weight | 825.81 g/mol |
| Exact Mass | 825.18 |
| IUPAC Name | 4,5-diphenyl-2-[[9-(4-phenyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum |
| SMILES | Oc1ccc(-c2ccccc2)c2c(-c3ccccc3)cc(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc(-c4ccccc4)ccn3)nc12.[Pt] |
| InChI | InChI=1S/C44H28N3O2.Pt/c48-40-23-22-34(30-14-6-2-7-15-30)43-37(31-16-8-3-9-17-31)28-42(46-44(40)43)49-33-20-21-36-35-18-10-11-19-38(35)47(39(36)27-33)41-26-32(24-25-45-41)29-12-4-1-5-13-29;/h1-26,28,48H;/q-1; |
| InChIKey | AYAAIUXIWXRVHE-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.81 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|