C26H16N3O2Pt- — CID 176606095
5-deuterio-2-[[9-(4-deuterio-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum (PubChem CID 176606095) has the molecular formula C26H16N3O2Pt- and a molecular weight of 599.52 g/mol. Its IUPAC name is 5-deuterio-2-[[9-(4-deuterio-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum.
| Compound Name | 5-deuterio-2-[[9-(4-deuterio-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum |
|---|---|
| PubChem CID | 176606095 |
| Molecular Formula | C26H16N3O2Pt- |
| Molecular Weight | 599.52 g/mol |
| Exact Mass | 599.10 |
| IUPAC Name | 5-deuterio-2-[[9-(4-deuterio-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum |
| SMILES | [2H]c1ccnc(-n2c3[c-]c(Oc4ccc5c([2H])ccc(O)c5n4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C26H16N3O2.Pt/c30-23-9-5-6-17-11-14-25(28-26(17)23)31-18-12-13-20-19-7-1-2-8-21(19)29(22(20)16-18)24-10-3-4-15-27-24;/h1-15,30H;/q-1;/i3D,6D; |
| InChIKey | BJLWZHVQZPSIOB-CNCQPPFRSA-N |
| XLogP | 6.02 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.52 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|