C28H18N3O2Pt- — CID 164823448
platinum;2-[3-(9-pyridin-2-ylpyrido[2,3-b]indol-2-yl)oxybenzene-2-id-1-yl]phenol (PubChem CID 164823448) has the molecular formula C28H18N3O2Pt- and a molecular weight of 623.55 g/mol. Its IUPAC name is platinum;2-[3-(9-pyridin-2-ylpyrido[2,3-b]indol-2-yl)oxybenzene-2-id-1-yl]phenol.
| Compound Name | platinum;2-[3-(9-pyridin-2-ylpyrido[2,3-b]indol-2-yl)oxybenzene-2-id-1-yl]phenol |
|---|---|
| PubChem CID | 164823448 |
| Molecular Formula | C28H18N3O2Pt- |
| Molecular Weight | 623.55 g/mol |
| Exact Mass | 623.11 |
| IUPAC Name | platinum;2-[3-(9-pyridin-2-ylpyrido[2,3-b]indol-2-yl)oxybenzene-2-id-1-yl]phenol |
| SMILES | Oc1ccccc1-c1[c-]c(Oc2ccc3c4ccccc4n(-c4ccccn4)c3n2)ccc1.[Pt] |
| InChI | InChI=1S/C28H18N3O2.Pt/c32-25-13-4-2-10-21(25)19-8-7-9-20(18-19)33-27-16-15-23-22-11-1-3-12-24(22)31(28(23)30-27)26-14-5-6-17-29-26;/h1-17,32H;/q-1; |
| InChIKey | NYEFGBKJMNSRII-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|