C29H22N3OPt- — CID 176606465
2-[2-[9-(4,5-dideuterio-2-pyridinyl)-1H-carbazol-1-id-2-yl]propan-2-yl]quinolin-8-ol;platinum (PubChem CID 176606465) has the molecular formula C29H22N3OPt- and a molecular weight of 625.61 g/mol. Its IUPAC name is 2-[2-[9-(4,5-dideuterio-2-pyridinyl)-1H-carbazol-1-id-2-yl]propan-2-yl]quinolin-8-ol;platinum.
| Compound Name | 2-[2-[9-(4,5-dideuterio-2-pyridinyl)-1H-carbazol-1-id-2-yl]propan-2-yl]quinolin-8-ol;platinum |
|---|---|
| PubChem CID | 176606465 |
| Molecular Formula | C29H22N3OPt- |
| Molecular Weight | 625.61 g/mol |
| Exact Mass | 625.15 |
| IUPAC Name | 2-[2-[9-(4,5-dideuterio-2-pyridinyl)-1H-carbazol-1-id-2-yl]propan-2-yl]quinolin-8-ol;platinum |
| SMILES | [2H]c1cnc(-n2c3[c-]c(C(C)(C)c4ccc5cccc(O)c5n4)ccc3c3ccccc32)cc1[2H].[Pt] |
| InChI | InChI=1S/C29H22N3O.Pt/c1-29(2,26-16-13-19-8-7-11-25(33)28(19)31-26)20-14-15-22-21-9-3-4-10-23(21)32(24(22)18-20)27-12-5-6-17-30-27;/h3-17,33H,1-2H3;/q-1;/i5D,6D; |
| InChIKey | NSOAAYIHOVFUCJ-CFFLFGFNSA-N |
| XLogP | 6.56 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.61 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|