C30H25N3O2 — CID 176606543
2-[4-tert-butyl-9-(3,5-dideuterio-2-pyridinyl)carbazol-2-yl]oxyquinolin-8-ol (PubChem CID 176606543) has the molecular formula C30H25N3O2 and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-[4-tert-butyl-9-(3,5-dideuterio-2-pyridinyl)carbazol-2-yl]oxyquinolin-8-ol.
| Compound Name | 2-[4-tert-butyl-9-(3,5-dideuterio-2-pyridinyl)carbazol-2-yl]oxyquinolin-8-ol |
|---|---|
| PubChem CID | 176606543 |
| Molecular Formula | C30H25N3O2 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 2-[4-tert-butyl-9-(3,5-dideuterio-2-pyridinyl)carbazol-2-yl]oxyquinolin-8-ol |
| SMILES | [2H]c1cnc(-n2c3ccccc3c3c(C(C)(C)C)cc(Oc4ccc5cccc(O)c5n4)cc32)c([2H])c1 |
| InChI | InChI=1S/C30H25N3O2/c1-30(2,3)22-17-20(35-27-15-14-19-9-8-12-25(34)29(19)32-27)18-24-28(22)21-10-4-5-11-23(21)33(24)26-13-6-7-16-31-26/h4-18,34H,1-3H3/i7D,13D |
| InChIKey | JOUIIZQCCKBERS-AUEYOAFKSA-N |
| XLogP | 7.52 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |