C26H17N3OS — CID 176606135
2-(3,6-dideuterio-9-pyridin-2-ylcarbazol-2-yl)sulfanylquinolin-8-ol (PubChem CID 176606135) has the molecular formula C26H17N3OS and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-(3,6-dideuterio-9-pyridin-2-ylcarbazol-2-yl)sulfanylquinolin-8-ol.
| Compound Name | 2-(3,6-dideuterio-9-pyridin-2-ylcarbazol-2-yl)sulfanylquinolin-8-ol |
|---|---|
| PubChem CID | 176606135 |
| Molecular Formula | C26H17N3OS |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-(3,6-dideuterio-9-pyridin-2-ylcarbazol-2-yl)sulfanylquinolin-8-ol |
| SMILES | [2H]c1ccc2c(c1)c1cc([2H])c(Sc3ccc4cccc(O)c4n3)cc1n2-c1ccccn1 |
| InChI | InChI=1S/C26H17N3OS/c30-23-9-5-6-17-11-14-25(28-26(17)23)31-18-12-13-20-19-7-1-2-8-21(19)29(22(20)16-18)24-10-3-4-15-27-24/h1-16,30H/i1D,12D |
| InChIKey | XIZWHCSBPSWLRO-WLDPALOGSA-N |
| XLogP | 6.58 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |