C30H24N3O2Pt- — CID 176606798
5,7-dimethyl-2-[[8-methyl-9-(6-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum (PubChem CID 176606798) has the molecular formula C30H24N3O2Pt- and a molecular weight of 653.62 g/mol. Its IUPAC name is 5,7-dimethyl-2-[[8-methyl-9-(6-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum.
| Compound Name | 5,7-dimethyl-2-[[8-methyl-9-(6-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum |
|---|---|
| PubChem CID | 176606798 |
| Molecular Formula | C30H24N3O2Pt- |
| Molecular Weight | 653.62 g/mol |
| Exact Mass | 653.15 |
| IUPAC Name | 5,7-dimethyl-2-[[8-methyl-9-(6-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinolin-8-ol;platinum |
| SMILES | Cc1cccc(-n2c3[c-]c(Oc4ccc5c(C)cc(C)c(O)c5n4)ccc3c3cccc(C)c32)n1.[Pt] |
| InChI | InChI=1S/C30H24N3O2.Pt/c1-17-7-5-9-24-23-12-11-21(16-25(23)33(29(17)24)26-10-6-8-20(4)31-26)35-27-14-13-22-18(2)15-19(3)30(34)28(22)32-27;/h5-15,34H,1-4H3;/q-1; |
| InChIKey | PGDJUXRBRHHMGH-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.62 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|