C31H27N4O2Pt- — CID 176605913
8-tert-butyl-6-[[8-methyl-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-1,5-naphthyridin-4-ol;platinum (PubChem CID 176605913) has the molecular formula C31H27N4O2Pt- and a molecular weight of 682.66 g/mol. Its IUPAC name is 8-tert-butyl-6-[[8-methyl-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-1,5-naphthyridin-4-ol;platinum.
| Compound Name | 8-tert-butyl-6-[[8-methyl-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-1,5-naphthyridin-4-ol;platinum |
|---|---|
| PubChem CID | 176605913 |
| Molecular Formula | C31H27N4O2Pt- |
| Molecular Weight | 682.66 g/mol |
| Exact Mass | 682.18 |
| IUPAC Name | 8-tert-butyl-6-[[8-methyl-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-1,5-naphthyridin-4-ol;platinum |
| SMILES | Cc1ccnc(-n2c3[c-]c(Oc4cc(C(C)(C)C)c5nccc(O)c5n4)ccc3c3cccc(C)c32)c1.[Pt] |
| InChI | InChI=1S/C31H27N4O2.Pt/c1-18-11-13-32-26(15-18)35-24-16-20(9-10-21(24)22-8-6-7-19(2)30(22)35)37-27-17-23(31(3,4)5)28-29(34-27)25(36)12-14-33-28;/h6-15,17H,1-5H3,(H,33,36);/q-1; |
| InChIKey | MRKPGPAERIRWNS-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.66 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|