C36H35N4OPtSi- — CID 162465469
[3-(3-tert-butyl-2,1,3-benzoxadiazol-2-ium-1-yl)benzene-2-id-1-yl]-dimethyl-[9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]silane;platinum (PubChem CID 162465469) has the molecular formula C36H35N4OPtSi- and a molecular weight of 762.87 g/mol. Its IUPAC name is [3-(3-tert-butyl-2,1,3-benzoxadiazol-2-ium-1-yl)benzene-2-id-1-yl]-dimethyl-[9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]silane;platinum.
| Compound Name | [3-(3-tert-butyl-2,1,3-benzoxadiazol-2-ium-1-yl)benzene-2-id-1-yl]-dimethyl-[9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]silane;platinum |
|---|---|
| PubChem CID | 162465469 |
| Molecular Formula | C36H35N4OPtSi- |
| Molecular Weight | 762.87 g/mol |
| Exact Mass | 762.22 |
| IUPAC Name | [3-(3-tert-butyl-2,1,3-benzoxadiazol-2-ium-1-yl)benzene-2-id-1-yl]-dimethyl-[9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]silane;platinum |
| SMILES | Cc1ccnc(-n2c3[c-]c([Si](C)(C)c4[c-]c(N5[OH+]N(C(C)(C)C)c6ccccc65)ccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C36H34N4OSi.Pt/c1-25-20-21-37-35(22-25)38-31-15-8-7-14-29(31)30-19-18-28(24-34(30)38)42(5,6)27-13-11-12-26(23-27)39-32-16-9-10-17-33(32)40(41-39)36(2,3)4;/h7-22H,1-6H3;/q-2;/p+1 |
| InChIKey | UNADJOYELYABND-UHFFFAOYSA-O |
| XLogP | 7.50 |
| TPSA | 37.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.87 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|