C45H35N4O2Pt- — CID 162465358
3-tert-butyl-1-[3-[[9-[4-(2-phenylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-2,1,3-benzoxadiazol-2-ium;platinum (PubChem CID 162465358) has the molecular formula C45H35N4O2Pt- and a molecular weight of 858.88 g/mol. Its IUPAC name is 3-tert-butyl-1-[3-[[9-[4-(2-phenylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-2,1,3-benzoxadiazol-2-ium;platinum.
| Compound Name | 3-tert-butyl-1-[3-[[9-[4-(2-phenylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-2,1,3-benzoxadiazol-2-ium;platinum |
|---|---|
| PubChem CID | 162465358 |
| Molecular Formula | C45H35N4O2Pt- |
| Molecular Weight | 858.88 g/mol |
| Exact Mass | 858.24 |
| IUPAC Name | 3-tert-butyl-1-[3-[[9-[4-(2-phenylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-2,1,3-benzoxadiazol-2-ium;platinum |
| SMILES | CC(C)(C)N1[OH+]N(c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc(-c4ccccc4-c4ccccc4)ccn3)ccc2)c2ccccc21.[Pt] |
| InChI | InChI=1S/C45H34N4O2.Pt/c1-45(2,3)49-42-23-12-11-22-41(42)48(51-49)33-16-13-17-34(29-33)50-35-24-25-39-38-20-9-10-21-40(38)47(43(39)30-35)44-28-32(26-27-46-44)37-19-8-7-18-36(37)31-14-5-4-6-15-31;/h4-28H,1-3H3;/q-2;/p+1 |
| InChIKey | MYGNGUDSKKNKFE-UHFFFAOYSA-O |
| XLogP | 11.50 |
| TPSA | 46.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.88 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|