C45H43N4OPt- — CID 162465343
3-tert-butyl-1-[3-[2-[9-[4-(2-propan-2-ylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]propan-2-yl]benzene-2-id-1-yl]-2,1,3-benzoxadiazol-2-ium;platinum (PubChem CID 162465343) has the molecular formula C45H43N4OPt- and a molecular weight of 850.94 g/mol. Its IUPAC name is 3-tert-butyl-1-[3-[2-[9-[4-(2-propan-2-ylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]propan-2-yl]benzene-2-id-1-yl]-2,1,3-benzoxadiazol-2-ium;platinum.
| Compound Name | 3-tert-butyl-1-[3-[2-[9-[4-(2-propan-2-ylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]propan-2-yl]benzene-2-id-1-yl]-2,1,3-benzoxadiazol-2-ium;platinum |
|---|---|
| PubChem CID | 162465343 |
| Molecular Formula | C45H43N4OPt- |
| Molecular Weight | 850.94 g/mol |
| Exact Mass | 850.31 |
| IUPAC Name | 3-tert-butyl-1-[3-[2-[9-[4-(2-propan-2-ylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]propan-2-yl]benzene-2-id-1-yl]-2,1,3-benzoxadiazol-2-ium;platinum |
| SMILES | CC(C)c1ccccc1-c1ccnc(-n2c3[c-]c(C(C)(C)c4[c-]c(N5[OH+]N(C(C)(C)C)c6ccccc65)ccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C45H42N4O.Pt/c1-30(2)35-17-8-9-18-36(35)31-25-26-46-43(27-31)47-39-20-11-10-19-37(39)38-24-23-33(29-42(38)47)45(6,7)32-15-14-16-34(28-32)48-40-21-12-13-22-41(40)49(50-48)44(3,4)5;/h8-27,30H,1-7H3;/q-2;/p+1 |
| InChIKey | LOQPRJDMZCLQQY-UHFFFAOYSA-O |
| XLogP | 11.49 |
| TPSA | 37.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.94 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|