C52H43N4OPtSi- — CID 162465277
[9-[4-(2,6-diphenylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]-dimethyl-[3-(3-propan-2-yl-2,1,3-benzoxadiazol-2-ium-1-yl)benzene-2-id-1-yl]silane;platinum (PubChem CID 162465277) has the molecular formula C52H43N4OPtSi- and a molecular weight of 963.11 g/mol. Its IUPAC name is [9-[4-(2,6-diphenylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]-dimethyl-[3-(3-propan-2-yl-2,1,3-benzoxadiazol-2-ium-1-yl)benzene-2-id-1-yl]silane;platinum.
| Compound Name | [9-[4-(2,6-diphenylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]-dimethyl-[3-(3-propan-2-yl-2,1,3-benzoxadiazol-2-ium-1-yl)benzene-2-id-1-yl]silane;platinum |
|---|---|
| PubChem CID | 162465277 |
| Molecular Formula | C52H43N4OPtSi- |
| Molecular Weight | 963.11 g/mol |
| Exact Mass | 962.29 |
| IUPAC Name | [9-[4-(2,6-diphenylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]-dimethyl-[3-(3-propan-2-yl-2,1,3-benzoxadiazol-2-ium-1-yl)benzene-2-id-1-yl]silane;platinum |
| SMILES | CC(C)N1[OH+]N(c2[c-]c([Si](C)(C)c3[c-]c4c(cc3)c3ccccc3n4-c3cc(-c4c(-c5ccccc5)cccc4-c4ccccc4)ccn3)ccc2)c2ccccc21.[Pt] |
| InChI | InChI=1S/C52H42N4OSi.Pt/c1-36(2)55-48-27-13-14-28-49(48)56(57-55)40-21-15-22-41(34-40)58(3,4)42-29-30-46-45-23-11-12-26-47(45)54(50(46)35-42)51-33-39(31-32-53-51)52-43(37-17-7-5-8-18-37)24-16-25-44(52)38-19-9-6-10-20-38;/h5-33,36H,1-4H3;/q-2;/p+1 |
| InChIKey | AALVGLSTQFCCSI-UHFFFAOYSA-O |
| XLogP | 11.81 |
| TPSA | 37.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.11 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|