C53H35N4OPtS- — CID 162465328
3-[3-[[9-[4-(2,6-diphenylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]sulfanyl]benzene-2-id-1-yl]-1-phenyl-2,1,3-benzoxadiazol-2-ium;platinum (PubChem CID 162465328) has the molecular formula C53H35N4OPtS- and a molecular weight of 971.04 g/mol. Its IUPAC name is 3-[3-[[9-[4-(2,6-diphenylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]sulfanyl]benzene-2-id-1-yl]-1-phenyl-2,1,3-benzoxadiazol-2-ium;platinum.
| Compound Name | 3-[3-[[9-[4-(2,6-diphenylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]sulfanyl]benzene-2-id-1-yl]-1-phenyl-2,1,3-benzoxadiazol-2-ium;platinum |
|---|---|
| PubChem CID | 162465328 |
| Molecular Formula | C53H35N4OPtS- |
| Molecular Weight | 971.04 g/mol |
| Exact Mass | 970.22 |
| IUPAC Name | 3-[3-[[9-[4-(2,6-diphenylphenyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]sulfanyl]benzene-2-id-1-yl]-1-phenyl-2,1,3-benzoxadiazol-2-ium;platinum |
| SMILES | [Pt].[c-]1c(Sc2[c-]c3c(cc2)c2ccccc2n3-c2cc(-c3c(-c4ccccc4)cccc3-c3ccccc3)ccn2)cccc1N1[OH+]N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C53H34N4OS.Pt/c1-4-16-37(17-5-1)44-25-15-26-45(38-18-6-2-7-19-38)53(44)39-32-33-54-52(34-39)55-48-27-11-10-24-46(48)47-31-30-43(36-51(47)55)59-42-23-14-22-41(35-42)57-50-29-13-12-28-49(50)56(58-57)40-20-8-3-9-21-40;/h1-34H;/q-2;/p+1 |
| InChIKey | BYIZHLJTNBKXDL-UHFFFAOYSA-O |
| XLogP | 14.06 |
| TPSA | 37.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.04 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|