C43H33N4OPtSi- — CID 162465252
[3-(1-methyl-2,1,3-benzoxadiazol-2-ium-3-yl)benzene-2-id-1-yl]-diphenyl-[9-[4-(trideuteriomethyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]silane;platinum (PubChem CID 162465252) has the molecular formula C43H33N4OPtSi- and a molecular weight of 847.95 g/mol. Its IUPAC name is [3-(1-methyl-2,1,3-benzoxadiazol-2-ium-3-yl)benzene-2-id-1-yl]-diphenyl-[9-[4-(trideuteriomethyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]silane;platinum.
| Compound Name | [3-(1-methyl-2,1,3-benzoxadiazol-2-ium-3-yl)benzene-2-id-1-yl]-diphenyl-[9-[4-(trideuteriomethyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]silane;platinum |
|---|---|
| PubChem CID | 162465252 |
| Molecular Formula | C43H33N4OPtSi- |
| Molecular Weight | 847.95 g/mol |
| Exact Mass | 847.23 |
| IUPAC Name | [3-(1-methyl-2,1,3-benzoxadiazol-2-ium-3-yl)benzene-2-id-1-yl]-diphenyl-[9-[4-(trideuteriomethyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]silane;platinum |
| SMILES | [2H]C([2H])([2H])c1ccnc(-n2c3[c-]c([Si](c4[c-]c(N5[OH+]N(C)c6ccccc65)ccc4)(c4ccccc4)c4ccccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C43H32N4OSi.Pt/c1-31-26-27-44-43(28-31)46-39-21-10-9-20-37(39)38-25-24-36(30-42(38)46)49(33-15-5-3-6-16-33,34-17-7-4-8-18-34)35-19-13-14-32(29-35)47-41-23-12-11-22-40(41)45(2)48-47;/h3-28H,1-2H3;/q-2;/p+1/i1D3; |
| InChIKey | MYLKRHQHLPYIKQ-NIIDSAIPSA-O |
| XLogP | 6.89 |
| TPSA | 37.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.95 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|