C46H37N4OPt- — CID 162465541
1-[3-[diphenyl-[9-[4-(trideuteriomethyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]methyl]benzene-2-id-1-yl]-3-propan-2-yl-2,1,3-benzoxadiazol-2-ium;platinum (PubChem CID 162465541) has the molecular formula C46H37N4OPt- and a molecular weight of 859.93 g/mol. Its IUPAC name is 1-[3-[diphenyl-[9-[4-(trideuteriomethyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]methyl]benzene-2-id-1-yl]-3-propan-2-yl-2,1,3-benzoxadiazol-2-ium;platinum.
| Compound Name | 1-[3-[diphenyl-[9-[4-(trideuteriomethyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]methyl]benzene-2-id-1-yl]-3-propan-2-yl-2,1,3-benzoxadiazol-2-ium;platinum |
|---|---|
| PubChem CID | 162465541 |
| Molecular Formula | C46H37N4OPt- |
| Molecular Weight | 859.93 g/mol |
| Exact Mass | 859.28 |
| IUPAC Name | 1-[3-[diphenyl-[9-[4-(trideuteriomethyl)-2-pyridinyl]-1H-carbazol-1-id-2-yl]methyl]benzene-2-id-1-yl]-3-propan-2-yl-2,1,3-benzoxadiazol-2-ium;platinum |
| SMILES | [2H]C([2H])([2H])c1ccnc(-n2c3[c-]c(C(c4[c-]c(N5[OH+]N(C(C)C)c6ccccc65)ccc4)(c4ccccc4)c4ccccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C46H36N4O.Pt/c1-32(2)49-42-23-12-13-24-43(42)50(51-49)38-20-14-19-36(30-38)46(34-15-6-4-7-16-34,35-17-8-5-9-18-35)37-25-26-40-39-21-10-11-22-41(39)48(44(40)31-37)45-29-33(3)27-28-47-45;/h4-29,32H,1-3H3;/q-2;/p+1/i3D3; |
| InChIKey | MWLLECSNBXFFHZ-FJCVKDQNSA-O |
| XLogP | 10.67 |
| TPSA | 37.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.93 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|