C37H28N5OPt- — CID 162465205
N-phenyl-N-[3-[3-(trideuteriomethyl)-2,1,3-benzoxadiazol-2-ium-1-yl]benzene-2-id-1-yl]-9-[4-(trideuteriomethyl)-2-pyridinyl]-1H-carbazol-1-id-2-amine;platinum (PubChem CID 162465205) has the molecular formula C37H28N5OPt- and a molecular weight of 759.78 g/mol. Its IUPAC name is N-phenyl-N-[3-[3-(trideuteriomethyl)-2,1,3-benzoxadiazol-2-ium-1-yl]benzene-2-id-1-yl]-9-[4-(trideuteriomethyl)-2-pyridinyl]-1H-carbazol-1-id-2-amine;platinum.
| Compound Name | N-phenyl-N-[3-[3-(trideuteriomethyl)-2,1,3-benzoxadiazol-2-ium-1-yl]benzene-2-id-1-yl]-9-[4-(trideuteriomethyl)-2-pyridinyl]-1H-carbazol-1-id-2-amine;platinum |
|---|---|
| PubChem CID | 162465205 |
| Molecular Formula | C37H28N5OPt- |
| Molecular Weight | 759.78 g/mol |
| Exact Mass | 759.23 |
| IUPAC Name | N-phenyl-N-[3-[3-(trideuteriomethyl)-2,1,3-benzoxadiazol-2-ium-1-yl]benzene-2-id-1-yl]-9-[4-(trideuteriomethyl)-2-pyridinyl]-1H-carbazol-1-id-2-amine;platinum |
| SMILES | [2H]C([2H])([2H])c1ccnc(-n2c3[c-]c(N(c4[c-]c(N5[OH+]N(C([2H])([2H])[2H])c6ccccc65)ccc4)c4ccccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C37H27N5O.Pt/c1-26-21-22-38-37(23-26)41-33-16-7-6-15-31(33)32-20-19-29(25-36(32)41)40(27-11-4-3-5-12-27)28-13-10-14-30(24-28)42-35-18-9-8-17-34(35)39(2)43-42;/h3-23H,1-2H3;/q-2;/p+1/i1D3,2D3; |
| InChIKey | MDJVKVUQSXMVAW-TXHXQZCNSA-O |
| XLogP | 8.98 |
| TPSA | 40.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.78 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|