C53H62N4OPt — CID 153413301
9-(4-methyl-2-pyridinyl)-2-[3-[4-(2,3,4,5,6-pentatert-butylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153413301) has the molecular formula C53H62N4OPt and a molecular weight of 966.18 g/mol. Its IUPAC name is 9-(4-methyl-2-pyridinyl)-2-[3-[4-(2,3,4,5,6-pentatert-butylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 9-(4-methyl-2-pyridinyl)-2-[3-[4-(2,3,4,5,6-pentatert-butylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153413301 |
| Molecular Formula | C53H62N4OPt |
| Molecular Weight | 966.18 g/mol |
| Exact Mass | 965.46 |
| IUPAC Name | 9-(4-methyl-2-pyridinyl)-2-[3-[4-(2,3,4,5,6-pentatert-butylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) |
| SMILES | Cc1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5cc(-c6c(C(C)(C)C)c(C(C)(C)C)c(C(C)(C)C)c(C(C)(C)C)c6C(C)(C)C)cn5)ccc4)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C53H62N4O.Pt/c1-33-26-27-54-42(28-33)57-40-23-18-17-22-38(40)39-25-24-37(30-41(39)57)58-36-21-19-20-35(29-36)56-32-34(31-55-56)43-44(49(2,3)4)46(51(8,9)10)48(53(14,15)16)47(52(11,12)13)45(43)50(5,6)7;/h17-28,31-32H,1-16H3;/q-2;+2 |
| InChIKey | ZYLANBKXQNXRHR-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.18 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|