C45H46N4OPt — CID 153413163
9-(4-methyl-2-pyridinyl)-2-[3-[4-(2,4,6-tritert-butylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153413163) has the molecular formula C45H46N4OPt and a molecular weight of 853.97 g/mol. Its IUPAC name is 9-(4-methyl-2-pyridinyl)-2-[3-[4-(2,4,6-tritert-butylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 9-(4-methyl-2-pyridinyl)-2-[3-[4-(2,4,6-tritert-butylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153413163 |
| Molecular Formula | C45H46N4OPt |
| Molecular Weight | 853.97 g/mol |
| Exact Mass | 853.33 |
| IUPAC Name | 9-(4-methyl-2-pyridinyl)-2-[3-[4-(2,4,6-tritert-butylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) |
| SMILES | Cc1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5cc(-c6c(C(C)(C)C)cc(C(C)(C)C)cc6C(C)(C)C)cn5)ccc4)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C45H46N4O.Pt/c1-29-20-21-46-41(22-29)49-39-17-12-11-16-35(39)36-19-18-34(26-40(36)49)50-33-15-13-14-32(25-33)48-28-30(27-47-48)42-37(44(5,6)7)23-31(43(2,3)4)24-38(42)45(8,9)10;/h11-24,27-28H,1-10H3;/q-2;+2 |
| InChIKey | UKFYSENJISNYRC-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.97 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|