C43H42N4OPt — CID 153413546
9-(4-methyl-2-pyridinyl)-2-[3-[4-(2,3,4,5,6-pentaethylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153413546) has the molecular formula C43H42N4OPt and a molecular weight of 825.91 g/mol. Its IUPAC name is 9-(4-methyl-2-pyridinyl)-2-[3-[4-(2,3,4,5,6-pentaethylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 9-(4-methyl-2-pyridinyl)-2-[3-[4-(2,3,4,5,6-pentaethylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153413546 |
| Molecular Formula | C43H42N4OPt |
| Molecular Weight | 825.91 g/mol |
| Exact Mass | 825.30 |
| IUPAC Name | 9-(4-methyl-2-pyridinyl)-2-[3-[4-(2,3,4,5,6-pentaethylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CCc1c(CC)c(CC)c(-c2cnn(-c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C)ccn4)ccc3)c2)c(CC)c1CC.[Pt+2] |
| InChI | InChI=1S/C43H42N4O.Pt/c1-7-33-34(8-2)36(10-4)43(37(11-5)35(33)9-3)29-26-45-46(27-29)30-15-14-16-31(24-30)48-32-19-20-39-38-17-12-13-18-40(38)47(41(39)25-32)42-23-28(6)21-22-44-42;/h12-23,26-27H,7-11H2,1-6H3;/q-2;+2 |
| InChIKey | VGVOCMATAVEALT-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.91 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|