C36H27N3OPtS — CID 176605883
5-(4-tert-butylphenyl)-2-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]quinoline-8-thiolate;platinum(2+) (PubChem CID 176605883) has the molecular formula C36H27N3OPtS and a molecular weight of 744.78 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-2-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]quinoline-8-thiolate;platinum(2+).
| Compound Name | 5-(4-tert-butylphenyl)-2-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]quinoline-8-thiolate;platinum(2+) |
|---|---|
| PubChem CID | 176605883 |
| Molecular Formula | C36H27N3OPtS |
| Molecular Weight | 744.78 g/mol |
| Exact Mass | 744.15 |
| IUPAC Name | 5-(4-tert-butylphenyl)-2-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]quinoline-8-thiolate;platinum(2+) |
| SMILES | CC(C)(C)c1ccc(-c2ccc([S-])c3nc(Oc4[c-]c5c(cc4)c4ccccc4n5-c4ccccn4)ccc23)cc1.[Pt+2] |
| InChI | InChI=1S/C36H28N3OS.Pt/c1-36(2,3)24-13-11-23(12-14-24)26-17-19-32(41)35-29(26)18-20-34(38-35)40-25-15-16-28-27-8-4-5-9-30(27)39(31(28)22-25)33-10-6-7-21-37-33;/h4-21,41H,1-3H3;/q-1;+2/p-1 |
| InChIKey | IOJPOVGDIXTJAI-UHFFFAOYSA-M |
| XLogP | 9.19 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.78 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|