C58H43N4OPt-3 — CID 164731843
CID 164731843 (PubChem CID 164731843) has the molecular formula C58H43N4OPt-3 and a molecular weight of 1007.09 g/mol.
| Compound Name | CID 164731843 |
|---|---|
| PubChem CID | 164731843 |
| Molecular Formula | C58H43N4OPt-3 |
| Molecular Weight | 1007.09 g/mol |
| Exact Mass | 1006.31 |
| IUPAC Name | — |
| SMILES | CC1(C)c2cccnc2-n2c3[c-]c(Oc4[c-]c(N5[CH-]N(c6c(-c7ccccc7)cccc6-c6ccccc6)c6c5ccc5ccccc65)ccc4)ccc3c3cccc(c32)C1(C)C.[Pt] |
| InChI | InChI=1S/C58H43N4O.Pt/c1-57(2)49-28-15-27-48-47-32-31-43(36-52(47)62(54(48)49)56-50(58(57,3)4)29-16-34-59-56)63-42-23-13-22-41(35-42)60-37-61(55-46-24-12-11-21-40(46)30-33-51(55)60)53-44(38-17-7-5-8-18-38)25-14-26-45(53)39-19-9-6-10-20-39;/h5-34,37H,1-4H3;/q-3; |
| InChIKey | IXUTWBYFFIGMTJ-UHFFFAOYSA-N |
| XLogP | 15.03 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.09 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|