C66H41N4OPt-3 — CID 171460138
CID 171460138 (PubChem CID 171460138) has the molecular formula C66H41N4OPt-3 and a molecular weight of 1101.16 g/mol.
| Compound Name | CID 171460138 |
|---|---|
| PubChem CID | 171460138 |
| Molecular Formula | C66H41N4OPt-3 |
| Molecular Weight | 1101.16 g/mol |
| Exact Mass | 1100.29 |
| IUPAC Name | — |
| SMILES | [Pt].[c-]1c(Oc2[c-]c3c(cc2)c2cc(-c4ccccc4)cc4c5ccccc5c5ccccc5c5cccnc5n3c42)cccc1N1[CH-]N(c2c(-c3ccccc3)cccc2-c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C66H41N4O.Pt/c1-4-19-44(20-5-1)47-39-59-56-30-13-11-28-54(56)53-27-10-12-29-55(53)58-33-18-38-67-66(58)70-63-42-50(36-37-57(63)60(40-47)65(59)70)71-49-26-16-25-48(41-49)68-43-69(62-35-15-14-34-61(62)68)64-51(45-21-6-2-7-22-45)31-17-32-52(64)46-23-8-3-9-24-46;/h1-40,43H;/q-3; |
| InChIKey | ZRKCMGZDWNXKBY-UHFFFAOYSA-N |
| XLogP | 17.46 |
| TPSA | 33.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1101.16 |
| LogP ≤ 5 | 17.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|