About CID 171460217
CID 171460217 (PubChem CID 171460217) has the molecular formula C67H41N4OPt-3
and a molecular weight of 1113.17 g/mol.
Molecular Properties
| Compound Name | CID 171460217 |
| PubChem CID | 171460217 |
| Molecular Formula | C67H41N4OPt-3 |
| Molecular Weight | 1113.17 g/mol |
| Exact Mass | 1112.29 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2ccccc2)c(N2[CH-]N3c4[c-]c(Oc5[c-]c6c(cc5)c5cccc7c8ccccc8c8ccccc8c8cccnc8n6c75)ccc4-c4ccccc4-c4cccc2c43)c(-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C67H41N4O.Pt/c1-42-37-59(43-17-4-2-5-18-43)64(60(38-42)44-19-6-3-7-20-44)69-41-70-62-39-45(32-34-53(62)49-23-10-12-25-51(49)56-29-15-31-61(69)66(56)70)72-46-33-35-54-57-28-14-27-55-50-24-11-8-21-47(50)48-22-9-13-26-52(48)58-30-16-36-68-67(58)71(65(55)57)63(54)40-46;/h2-38,41H,1H3;/q-3; |
| InChIKey | IMFXIQSXFUAYFV-UHFFFAOYSA-N |
| XLogP | 17.75 |
| TPSA | 33.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 73 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1113.17 |
| LogP ≤ 5 | 17.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 171460217 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171460217?
The IUPAC name of CID 171460217 (CID 171460217) is not available.
What is the SMILES notation for CID 171460217?
The canonical SMILES for CID 171460217 is Cc1cc(-c2ccccc2)c(N2[CH-]N3c4[c-]c(Oc5[c-]c6c(cc5)c5cccc7c8ccccc8c8ccccc8c8cccnc8n6c75)ccc4-c4ccccc4-c4cccc2c43)c(-c2ccccc2)c1.[Pt].
What is the InChIKey of CID 171460217?
The InChIKey is IMFXIQSXFUAYFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C67H41N4O.Pt/c1-42-37-59(43-17-4-2-5-18-43)64(60(38-42)44-19-6-3-7-20-44)69-41-70-62-39-45(32-34-53(62)49-23-10-12-25-51(49)56-29-15-31-61(69)66(56)70)72-46-33-35-54-57-28-14-27-55-50-24-11-8-21-47(50)48-22-9-13-26-52(48)58-30-16-36-68-67(58)71(65(55)57)63(54)40-46;/h2-38,41H,1H3;/q-3;.
What are the key properties of CID 171460217?
CID 171460217 has a molecular weight of 1113.17 g/mol, XLogP of 17.75, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171460217 is sourced from PubChem (CID 171460217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).