C72H45N4OPt-3 — CID 171460189
CID 171460189 (PubChem CID 171460189) has the molecular formula C72H45N4OPt-3 and a molecular weight of 1177.26 g/mol.
| Compound Name | CID 171460189 |
|---|---|
| PubChem CID | 171460189 |
| Molecular Formula | C72H45N4OPt-3 |
| Molecular Weight | 1177.26 g/mol |
| Exact Mass | 1176.33 |
| IUPAC Name | — |
| SMILES | [Pt].[c-]1c(Oc2[c-]c3c(cc2-c2ccccc2)c2cc(-c4ccccc4)cc4c5ccccc5c5ccccc5c5cccnc5n3c42)cccc1N1[CH-]N(c2c(-c3ccccc3)cccc2-c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C72H45N4O.Pt/c1-5-22-48(23-6-1)52-42-64-60-35-16-14-33-58(60)57-32-13-15-34-59(57)61-38-21-41-73-72(61)76-68-46-69(62(51-28-11-4-12-29-51)45-63(68)65(43-52)71(64)76)77-54-31-19-30-53(44-54)74-47-75(67-40-18-17-39-66(67)74)70-55(49-24-7-2-8-25-49)36-20-37-56(70)50-26-9-3-10-27-50;/h1-43,45,47H;/q-3; |
| InChIKey | CSODCOXMWOELFP-UHFFFAOYSA-N |
| XLogP | 19.13 |
| TPSA | 33.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1177.26 |
| LogP ≤ 5 | 19.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|