C57H39N5Pt — CID 177105798
1-(2,6-diphenylphenyl)-3-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]-2H-benzimidazol-2-ide;platinum(4+);cyanide (PubChem CID 177105798) has the molecular formula C57H39N5Pt and a molecular weight of 989.05 g/mol. Its IUPAC name is 1-(2,6-diphenylphenyl)-3-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]-2H-benzimidazol-2-ide;platinum(4+);cyanide.
| Compound Name | 1-(2,6-diphenylphenyl)-3-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]-2H-benzimidazol-2-ide;platinum(4+);cyanide |
|---|---|
| PubChem CID | 177105798 |
| Molecular Formula | C57H39N5Pt |
| Molecular Weight | 989.05 g/mol |
| Exact Mass | 988.29 |
| IUPAC Name | 1-(2,6-diphenylphenyl)-3-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]-2H-benzimidazol-2-ide;platinum(4+);cyanide |
| SMILES | [C-]#N.[Pt+4].[c-]1c(N2[CH-]N(c3c(-c4ccccc4)cccc3-c3ccccc3)c3ccccc32)cccc1N1[CH-]N(c2c(-c3ccccc3)cccc2-c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C56H39N4.CN.Pt/c1-5-20-41(21-6-1)47-30-18-31-48(42-22-7-2-8-23-42)55(47)59-39-57(51-34-13-15-36-53(51)59)45-28-17-29-46(38-45)58-40-60(54-37-16-14-35-52(54)58)56-49(43-24-9-3-10-25-43)32-19-33-50(56)44-26-11-4-12-27-44;1-2;/h1-37,39-40H;;/q-3;-1;+4 |
| InChIKey | AAJPPCRUDAJRRP-UHFFFAOYSA-N |
| XLogP | 15.07 |
| TPSA | 36.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.05 |
| LogP ≤ 5 | 15.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|