C31H32N2 — CID 140855399
12,12,13,13,14,14-hexamethyl-10-phenyl-18-(trideuteriomethyl)-9,20-diazapentacyclo[9.7.2.02,7.08,20.015,19]icosa-1(18),2,4,6,8,10,15(19),16-octaene (PubChem CID 140855399) has the molecular formula C31H32N2 and a molecular weight of 435.63 g/mol. Its IUPAC name is 12,12,13,13,14,14-hexamethyl-10-phenyl-18-(trideuteriomethyl)-9,20-diazapentacyclo[9.7.2.02,7.08,20.015,19]icosa-1(18),2,4,6,8,10,15(19),16-octaene.
| Compound Name | 12,12,13,13,14,14-hexamethyl-10-phenyl-18-(trideuteriomethyl)-9,20-diazapentacyclo[9.7.2.02,7.08,20.015,19]icosa-1(18),2,4,6,8,10,15(19),16-octaene |
|---|---|
| PubChem CID | 140855399 |
| Molecular Formula | C31H32N2 |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | 12,12,13,13,14,14-hexamethyl-10-phenyl-18-(trideuteriomethyl)-9,20-diazapentacyclo[9.7.2.02,7.08,20.015,19]icosa-1(18),2,4,6,8,10,15(19),16-octaene |
| SMILES | [2H]C([2H])([2H])c1ccc2c3c1c1ccccc1c1nc(-c4ccccc4)c(n13)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C31H32N2/c1-19-17-18-23-26-24(19)21-15-11-12-16-22(21)28-32-25(20-13-9-8-10-14-20)27(33(26)28)30(4,5)31(6,7)29(23,2)3/h8-18H,1-7H3/i1D3 |
| InChIKey | OZLOGFFXEIKAFC-FIBGUPNXSA-N |
| XLogP | 8.21 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|