C21H23N2+ — CID 162781937
11-tert-butyl-1,12-dimethylimidazo[1,2-f]phenanthridin-1-ium (PubChem CID 162781937) has the molecular formula C21H23N2+ and a molecular weight of 303.43 g/mol. Its IUPAC name is 11-tert-butyl-1,12-dimethylimidazo[1,2-f]phenanthridin-1-ium.
| Compound Name | 11-tert-butyl-1,12-dimethylimidazo[1,2-f]phenanthridin-1-ium |
|---|---|
| PubChem CID | 162781937 |
| Molecular Formula | C21H23N2+ |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 11-tert-butyl-1,12-dimethylimidazo[1,2-f]phenanthridin-1-ium |
| SMILES | Cc1c(C(C)(C)C)ccc2c3ccccc3n3cc[n+](C)c3c12 |
| InChI | InChI=1S/C21H23N2/c1-14-17(21(2,3)4)11-10-16-15-8-6-7-9-18(15)23-13-12-22(5)20(23)19(14)16/h6-13H,1-5H3/q+1 |
| InChIKey | LNRQRYKPBHTNFP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|