C19H19N2+ — CID 11523244
1-butylimidazo[1,2-f]phenanthridin-1-ium (PubChem CID 11523244) has the molecular formula C19H19N2+ and a molecular weight of 275.38 g/mol. Its IUPAC name is 1-butylimidazo[1,2-f]phenanthridin-1-ium.
| Compound Name | 1-butylimidazo[1,2-f]phenanthridin-1-ium |
|---|---|
| PubChem CID | 11523244 |
| Molecular Formula | C19H19N2+ |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-butylimidazo[1,2-f]phenanthridin-1-ium |
| SMILES | CCCC[n+]1ccn2c3ccccc3c3ccccc3c21 |
| InChI | InChI=1S/C19H19N2/c1-2-3-12-20-13-14-21-18-11-7-6-9-16(18)15-8-4-5-10-17(15)19(20)21/h4-11,13-14H,2-3,12H2,1H3/q+1 |
| InChIKey | YYNSHZYLJDTMBF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|