C18H17IN2O — CID 11682848
6-butyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one iodide (PubChem CID 11682848) has the molecular formula C18H17IN2O and a molecular weight of 404.25 g/mol. Its IUPAC name is 6-butyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one iodide.
| Compound Name | 6-butyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one iodide |
|---|---|
| PubChem CID | 11682848 |
| Molecular Formula | C18H17IN2O |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 6-butyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one iodide |
| SMILES | CCCC[n+]1ccc2c3ccccc3n3c(=O)ccc1c23.[I-] |
| InChI | InChI=1S/C18H17N2O.HI/c1-2-3-11-19-12-10-14-13-6-4-5-7-15(13)20-17(21)9-8-16(19)18(14)20;/h4-10,12H,2-3,11H2,1H3;1H/q+1;/p-1 |
| InChIKey | NNYJTJOFJADDNM-UHFFFAOYSA-M |
| XLogP | 0.14 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|