C16H13N2O+ — CID 127041924
6-ethyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one (PubChem CID 127041924) has the molecular formula C16H13N2O+ and a molecular weight of 249.29 g/mol. Its IUPAC name is 6-ethyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one.
| Compound Name | 6-ethyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one |
|---|---|
| PubChem CID | 127041924 |
| Molecular Formula | C16H13N2O+ |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 6-ethyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one |
| SMILES | CC[n+]1ccc2c3ccccc3n3c(=O)ccc1c23 |
| InChI | InChI=1S/C16H13N2O/c1-2-17-10-9-12-11-5-3-4-6-13(11)18-15(19)8-7-14(17)16(12)18/h3-10H,2H2,1H3/q+1 |
| InChIKey | FBAHIVWJPQHBDU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|