C38H40N4+2 — CID 163683327
1-methyl-3-phenyl-2-(2,3,5-trimethylphenyl)imidazol-1-ium;1,9,11,12-tetramethylimidazo[1,2-f]phenanthridin-1-ium (PubChem CID 163683327) has the molecular formula C38H40N4+2 and a molecular weight of 552.77 g/mol. Its IUPAC name is 1-methyl-3-phenyl-2-(2,3,5-trimethylphenyl)imidazol-1-ium;1,9,11,12-tetramethylimidazo[1,2-f]phenanthridin-1-ium.
| Compound Name | 1-methyl-3-phenyl-2-(2,3,5-trimethylphenyl)imidazol-1-ium;1,9,11,12-tetramethylimidazo[1,2-f]phenanthridin-1-ium |
|---|---|
| PubChem CID | 163683327 |
| Molecular Formula | C38H40N4+2 |
| Molecular Weight | 552.77 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | 1-methyl-3-phenyl-2-(2,3,5-trimethylphenyl)imidazol-1-ium;1,9,11,12-tetramethylimidazo[1,2-f]phenanthridin-1-ium |
| SMILES | Cc1cc(C)c(C)c(-c2n(-c3ccccc3)cc[n+]2C)c1.Cc1cc(C)c2c3ccccc3n3cc[n+](C)c3c2c1C |
| InChI | InChI=1S/C19H19N2.C19H21N2/c1-12-11-13(2)17-15-7-5-6-8-16(15)21-10-9-20(4)19(21)18(17)14(12)3;1-14-12-15(2)16(3)18(13-14)19-20(4)10-11-21(19)17-8-6-5-7-9-17/h5-11H,1-4H3;5-13H,1-4H3/q2*+1 |
| InChIKey | MGTNNFGPMHKTOJ-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 17.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.77 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|