C33H27N2S+ — CID 171459067
7-carbazol-9-yl-2-methyl-1-(2,3,5-trimethylphenyl)-[1]benzothiolo[2,3-c]pyridin-2-ium (PubChem CID 171459067) has the molecular formula C33H27N2S+ and a molecular weight of 483.66 g/mol. Its IUPAC name is 7-carbazol-9-yl-2-methyl-1-(2,3,5-trimethylphenyl)-[1]benzothiolo[2,3-c]pyridin-2-ium.
| Compound Name | 7-carbazol-9-yl-2-methyl-1-(2,3,5-trimethylphenyl)-[1]benzothiolo[2,3-c]pyridin-2-ium |
|---|---|
| PubChem CID | 171459067 |
| Molecular Formula | C33H27N2S+ |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 7-carbazol-9-yl-2-methyl-1-(2,3,5-trimethylphenyl)-[1]benzothiolo[2,3-c]pyridin-2-ium |
| SMILES | Cc1cc(C)c(C)c(-c2c3sc4cc(-n5c6ccccc6c6ccccc65)ccc4c3cc[n+]2C)c1 |
| InChI | InChI=1S/C33H27N2S/c1-20-17-21(2)22(3)28(18-20)32-33-27(15-16-34(32)4)26-14-13-23(19-31(26)36-33)35-29-11-7-5-9-24(29)25-10-6-8-12-30(25)35/h5-19H,1-4H3/q+1 |
| InChIKey | YNMYQVFPOGCFNI-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|