C37H37N2+ — CID 171459002
3-(cyclopentylmethyl)-9-[2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium-6-yl]carbazole (PubChem CID 171459002) has the molecular formula C37H37N2+ and a molecular weight of 509.72 g/mol. Its IUPAC name is 3-(cyclopentylmethyl)-9-[2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium-6-yl]carbazole.
| Compound Name | 3-(cyclopentylmethyl)-9-[2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium-6-yl]carbazole |
|---|---|
| PubChem CID | 171459002 |
| Molecular Formula | C37H37N2+ |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | 3-(cyclopentylmethyl)-9-[2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium-6-yl]carbazole |
| SMILES | Cc1cc(C)c(C)c(-c2c3ccc(-n4c5ccccc5c5cc(CC6CCCC6)ccc54)cc3cc[n+]2C)c1 |
| InChI | InChI=1S/C37H37N2/c1-24-19-25(2)26(3)33(20-24)37-31-15-14-30(23-29(31)17-18-38(37)4)39-35-12-8-7-11-32(35)34-22-28(13-16-36(34)39)21-27-9-5-6-10-27/h7-8,11-20,22-23,27H,5-6,9-10,21H2,1-4H3/q+1 |
| InChIKey | DNPNJLCMGYBJDC-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|