C40H41GeN2+ — CID 171459239
[9-[1-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-methylisoquinolin-2-ium-6-yl]carbazol-1-yl]-trimethylgermane (PubChem CID 171459239) has the molecular formula C40H41GeN2+ and a molecular weight of 622.39 g/mol. Its IUPAC name is [9-[1-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-methylisoquinolin-2-ium-6-yl]carbazol-1-yl]-trimethylgermane.
| Compound Name | [9-[1-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-methylisoquinolin-2-ium-6-yl]carbazol-1-yl]-trimethylgermane |
|---|---|
| PubChem CID | 171459239 |
| Molecular Formula | C40H41GeN2+ |
| Molecular Weight | 622.39 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | [9-[1-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-methylisoquinolin-2-ium-6-yl]carbazol-1-yl]-trimethylgermane |
| SMILES | Cc1c(-c2c3ccc(-n4c5ccccc5c5cccc([Ge](C)(C)C)c54)cc3cc[n+]2C)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C40H41GeN2/c1-26-29-14-9-10-15-31(29)35(40(2,3)4)25-34(26)38-30-21-20-28(24-27(30)22-23-42(38)8)43-37-19-12-11-16-32(37)33-17-13-18-36(39(33)43)41(5,6)7/h9-25H,1-8H3/q+1 |
| InChIKey | YZXNGPDYPHRVKX-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.39 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|