C46H45N2+ — CID 171459317
4-(4-tert-butyl-1-methylnaphthalen-2-yl)-8-[4-(2,2-dimethylpropyl)carbazol-9-yl]-3-methylbenzo[f]isoquinolin-3-ium (PubChem CID 171459317) has the molecular formula C46H45N2+ and a molecular weight of 625.88 g/mol. Its IUPAC name is 4-(4-tert-butyl-1-methylnaphthalen-2-yl)-8-[4-(2,2-dimethylpropyl)carbazol-9-yl]-3-methylbenzo[f]isoquinolin-3-ium.
| Compound Name | 4-(4-tert-butyl-1-methylnaphthalen-2-yl)-8-[4-(2,2-dimethylpropyl)carbazol-9-yl]-3-methylbenzo[f]isoquinolin-3-ium |
|---|---|
| PubChem CID | 171459317 |
| Molecular Formula | C46H45N2+ |
| Molecular Weight | 625.88 g/mol |
| Exact Mass | 625.36 |
| IUPAC Name | 4-(4-tert-butyl-1-methylnaphthalen-2-yl)-8-[4-(2,2-dimethylpropyl)carbazol-9-yl]-3-methylbenzo[f]isoquinolin-3-ium |
| SMILES | Cc1c(-c2c3ccc4cc(-n5c6ccccc6c6c(CC(C)(C)C)cccc65)ccc4c3cc[n+]2C)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C46H45N2/c1-29-33-15-9-10-16-36(33)40(46(5,6)7)27-39(29)44-37-22-20-30-26-32(21-23-34(30)35(37)24-25-47(44)8)48-41-18-12-11-17-38(41)43-31(28-45(2,3)4)14-13-19-42(43)48/h9-27H,28H2,1-8H3/q+1 |
| InChIKey | ZIGLZLMDARMDOI-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.88 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|