C35H32N3+ — CID 155769608
2-tert-butyl-9-(4-carbazol-9-yl-1-methylpyridin-1-ium-2-yl)-1-methylcarbazole (PubChem CID 155769608) has the molecular formula C35H32N3+ and a molecular weight of 494.66 g/mol. Its IUPAC name is 2-tert-butyl-9-(4-carbazol-9-yl-1-methylpyridin-1-ium-2-yl)-1-methylcarbazole.
| Compound Name | 2-tert-butyl-9-(4-carbazol-9-yl-1-methylpyridin-1-ium-2-yl)-1-methylcarbazole |
|---|---|
| PubChem CID | 155769608 |
| Molecular Formula | C35H32N3+ |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 2-tert-butyl-9-(4-carbazol-9-yl-1-methylpyridin-1-ium-2-yl)-1-methylcarbazole |
| SMILES | Cc1c(C(C)(C)C)ccc2c3ccccc3n(-c3cc(-n4c5ccccc5c5ccccc54)cc[n+]3C)c12 |
| InChI | InChI=1S/C35H32N3/c1-23-29(35(2,3)4)19-18-28-27-14-8-11-17-32(27)38(34(23)28)33-22-24(20-21-36(33)5)37-30-15-9-6-12-25(30)26-13-7-10-16-31(26)37/h6-22H,1-5H3/q+1 |
| InChIKey | LTRRUXYMNISQFK-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|