C33H35N2O+ — CID 155769627
7-tert-butyl-5-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-6-methyl-[1]benzofuro[3,2-c]carbazole (PubChem CID 155769627) has the molecular formula C33H35N2O+ and a molecular weight of 475.66 g/mol. Its IUPAC name is 7-tert-butyl-5-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-6-methyl-[1]benzofuro[3,2-c]carbazole.
| Compound Name | 7-tert-butyl-5-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-6-methyl-[1]benzofuro[3,2-c]carbazole |
|---|---|
| PubChem CID | 155769627 |
| Molecular Formula | C33H35N2O+ |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 7-tert-butyl-5-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-6-methyl-[1]benzofuro[3,2-c]carbazole |
| SMILES | Cc1c(C(C)(C)C)c2c3ccccc3oc2c2c3ccccc3n(-c3cc(C(C)(C)C)cc[n+]3C)c12 |
| InChI | InChI=1S/C33H35N2O/c1-20-29(33(5,6)7)27-23-14-10-12-16-25(23)36-31(27)28-22-13-9-11-15-24(22)35(30(20)28)26-19-21(32(2,3)4)17-18-34(26)8/h9-19H,1-8H3/q+1 |
| InChIKey | CSTRRXJONBFRQJ-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|