C37H35BN3+ — CID 161082728
5-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-3,26-dimethyl-5,18-diaza-1-boraheptacyclo[14.11.1.02,14.04,12.06,11.020,28.022,27]octacosa-2,4(12),6,8,10,13,16(28),17,19,22,24,26-dodecaene (PubChem CID 161082728) has the molecular formula C37H35BN3+ and a molecular weight of 532.52 g/mol. Its IUPAC name is 5-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-3,26-dimethyl-5,18-diaza-1-boraheptacyclo[14.11.1.02,14.04,12.06,11.020,28.022,27]octacosa-2,4(12),6,8,10,13,16(28),17,19,22,24,26-dodecaene.
| Compound Name | 5-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-3,26-dimethyl-5,18-diaza-1-boraheptacyclo[14.11.1.02,14.04,12.06,11.020,28.022,27]octacosa-2,4(12),6,8,10,13,16(28),17,19,22,24,26-dodecaene |
|---|---|
| PubChem CID | 161082728 |
| Molecular Formula | C37H35BN3+ |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | 5-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-3,26-dimethyl-5,18-diaza-1-boraheptacyclo[14.11.1.02,14.04,12.06,11.020,28.022,27]octacosa-2,4(12),6,8,10,13,16(28),17,19,22,24,26-dodecaene |
| SMILES | Cc1cccc2c1B1c3c(cncc3Cc3cc4c5ccccc5n(-c5cc(C(C)(C)C)cc[n+]5C)c4c(C)c31)C2 |
| InChI | InChI=1S/C37H35BN3/c1-22-10-9-11-24-16-26-20-39-21-27-17-25-18-30-29-12-7-8-13-31(29)41(32-19-28(37(3,4)5)14-15-40(32)6)36(30)23(2)34(25)38(33(22)24)35(26)27/h7-15,18-21H,16-17H2,1-6H3/q+1 |
| InChIKey | HBMHPMKTDUAYNS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|