C20H19N2O+ — CID 158408043
1,3-dimethyl-9-(1-methylpyridin-1-ium-2-yl)carbazol-2-ol (PubChem CID 158408043) has the molecular formula C20H19N2O+ and a molecular weight of 303.39 g/mol. Its IUPAC name is 1,3-dimethyl-9-(1-methylpyridin-1-ium-2-yl)carbazol-2-ol.
| Compound Name | 1,3-dimethyl-9-(1-methylpyridin-1-ium-2-yl)carbazol-2-ol |
|---|---|
| PubChem CID | 158408043 |
| Molecular Formula | C20H19N2O+ |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1,3-dimethyl-9-(1-methylpyridin-1-ium-2-yl)carbazol-2-ol |
| SMILES | Cc1cc2c3ccccc3n(-c3cccc[n+]3C)c2c(C)c1O |
| InChI | InChI=1S/C20H18N2O/c1-13-12-16-15-8-4-5-9-17(15)22(19(16)14(2)20(13)23)18-10-6-7-11-21(18)3/h4-12H,1-3H3/p+1 |
| InChIKey | WVGVASMMZJNEGO-UHFFFAOYSA-O |
| XLogP | 3.93 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|