C19H18N3O+ — CID 158341161
6,8-dimethyl-9-(1-methylpyridin-1-ium-2-yl)pyrido[2,3-b]indol-7-ol (PubChem CID 158341161) has the molecular formula C19H18N3O+ and a molecular weight of 304.37 g/mol. Its IUPAC name is 6,8-dimethyl-9-(1-methylpyridin-1-ium-2-yl)pyrido[2,3-b]indol-7-ol.
| Compound Name | 6,8-dimethyl-9-(1-methylpyridin-1-ium-2-yl)pyrido[2,3-b]indol-7-ol |
|---|---|
| PubChem CID | 158341161 |
| Molecular Formula | C19H18N3O+ |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 6,8-dimethyl-9-(1-methylpyridin-1-ium-2-yl)pyrido[2,3-b]indol-7-ol |
| SMILES | Cc1cc2c3cccnc3n(-c3cccc[n+]3C)c2c(C)c1O |
| InChI | InChI=1S/C19H17N3O/c1-12-11-15-14-7-6-9-20-19(14)22(17(15)13(2)18(12)23)16-8-4-5-10-21(16)3/h4-11H,1-3H3/p+1 |
| InChIKey | YFSFQYKXFUUVLW-UHFFFAOYSA-O |
| XLogP | 3.33 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|