C31H26N4+2 — CID 177263811
1-methyl-2-(1-methylcarbazol-9-yl)-9-(1-methylpyridin-1-ium-2-yl)pyrido[2,3-b]indol-1-ium (PubChem CID 177263811) has the molecular formula C31H26N4+2 and a molecular weight of 454.58 g/mol. Its IUPAC name is 1-methyl-2-(1-methylcarbazol-9-yl)-9-(1-methylpyridin-1-ium-2-yl)pyrido[2,3-b]indol-1-ium.
| Compound Name | 1-methyl-2-(1-methylcarbazol-9-yl)-9-(1-methylpyridin-1-ium-2-yl)pyrido[2,3-b]indol-1-ium |
|---|---|
| PubChem CID | 177263811 |
| Molecular Formula | C31H26N4+2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 1-methyl-2-(1-methylcarbazol-9-yl)-9-(1-methylpyridin-1-ium-2-yl)pyrido[2,3-b]indol-1-ium |
| SMILES | Cc1cccc2c3ccccc3n(-c3ccc4c5ccccc5n(-c5cccc[n+]5C)c4[n+]3C)c12 |
| InChI | InChI=1S/C31H26N4/c1-21-11-10-14-24-22-12-4-6-15-26(22)34(30(21)24)29-19-18-25-23-13-5-7-16-27(23)35(31(25)33(29)3)28-17-8-9-20-32(28)2/h4-20H,1-3H3/q+2 |
| InChIKey | RHAPHLQNODQOBQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|