C22H23N2O+ — CID 160527495
9-[1,5-dimethyl-4-(trideuteriomethyl)pyridin-1-ium-2-yl]-1,3-dimethylcarbazol-2-ol (PubChem CID 160527495) has the molecular formula C22H23N2O+ and a molecular weight of 334.46 g/mol. Its IUPAC name is 9-[1,5-dimethyl-4-(trideuteriomethyl)pyridin-1-ium-2-yl]-1,3-dimethylcarbazol-2-ol.
| Compound Name | 9-[1,5-dimethyl-4-(trideuteriomethyl)pyridin-1-ium-2-yl]-1,3-dimethylcarbazol-2-ol |
|---|---|
| PubChem CID | 160527495 |
| Molecular Formula | C22H23N2O+ |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 9-[1,5-dimethyl-4-(trideuteriomethyl)pyridin-1-ium-2-yl]-1,3-dimethylcarbazol-2-ol |
| SMILES | [2H]C([2H])([2H])c1cc(-n2c3ccccc3c3cc(C)c(O)c(C)c32)[n+](C)cc1C |
| InChI | InChI=1S/C22H22N2O/c1-13-11-20(23(5)12-15(13)3)24-19-9-7-6-8-17(19)18-10-14(2)22(25)16(4)21(18)24/h6-12H,1-5H3/p+1/i1D3 |
| InChIKey | QIZWAKKNYFIEPG-FIBGUPNXSA-O |
| XLogP | 4.55 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|