C23H26N3+ — CID 159837794
1,3,6,7-tetramethyl-5-(1,4,5-trimethylpyridin-1-ium-2-yl)pyrido[4,3-b]indole (PubChem CID 159837794) has the molecular formula C23H26N3+ and a molecular weight of 344.48 g/mol. Its IUPAC name is 1,3,6,7-tetramethyl-5-(1,4,5-trimethylpyridin-1-ium-2-yl)pyrido[4,3-b]indole.
| Compound Name | 1,3,6,7-tetramethyl-5-(1,4,5-trimethylpyridin-1-ium-2-yl)pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 159837794 |
| Molecular Formula | C23H26N3+ |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1,3,6,7-tetramethyl-5-(1,4,5-trimethylpyridin-1-ium-2-yl)pyrido[4,3-b]indole |
| SMILES | Cc1cc2c(c(C)n1)c1ccc(C)c(C)c1n2-c1cc(C)c(C)c[n+]1C |
| InChI | InChI=1S/C23H26N3/c1-13-8-9-19-22-18(6)24-16(4)11-20(22)26(23(19)17(13)5)21-10-14(2)15(3)12-25(21)7/h8-12H,1-7H3/q+1 |
| InChIKey | ADUXGIJGABKMPU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|