C22H23N2+ — CID 161135803
9-(6-deuterio-1,4-dimethylpyridin-1-ium-2-yl)-1,2,3-trimethylcarbazole (PubChem CID 161135803) has the molecular formula C22H23N2+ and a molecular weight of 316.45 g/mol. Its IUPAC name is 9-(6-deuterio-1,4-dimethylpyridin-1-ium-2-yl)-1,2,3-trimethylcarbazole.
| Compound Name | 9-(6-deuterio-1,4-dimethylpyridin-1-ium-2-yl)-1,2,3-trimethylcarbazole |
|---|---|
| PubChem CID | 161135803 |
| Molecular Formula | C22H23N2+ |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 9-(6-deuterio-1,4-dimethylpyridin-1-ium-2-yl)-1,2,3-trimethylcarbazole |
| SMILES | [2H]c1cc(C)cc(-n2c3ccccc3c3cc(C)c(C)c(C)c32)[n+]1C |
| InChI | InChI=1S/C22H23N2/c1-14-10-11-23(5)21(12-14)24-20-9-7-6-8-18(20)19-13-15(2)16(3)17(4)22(19)24/h6-13H,1-5H3/q+1/i11D |
| InChIKey | IQIBQFNEUCJJPL-WORMITQPSA-N |
| XLogP | 4.84 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|