C34H35N2Si+ — CID 171459391
[4-carbazol-9-yl-2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium-6-yl]-trimethylsilane (PubChem CID 171459391) has the molecular formula C34H35N2Si+ and a molecular weight of 499.75 g/mol. Its IUPAC name is [4-carbazol-9-yl-2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium-6-yl]-trimethylsilane.
| Compound Name | [4-carbazol-9-yl-2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium-6-yl]-trimethylsilane |
|---|---|
| PubChem CID | 171459391 |
| Molecular Formula | C34H35N2Si+ |
| Molecular Weight | 499.75 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | [4-carbazol-9-yl-2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium-6-yl]-trimethylsilane |
| SMILES | Cc1cc(C)c(C)c(-c2c3ccc([Si](C)(C)C)cc3c(-n3c4ccccc4c4ccccc43)c[n+]2C)c1 |
| InChI | InChI=1S/C34H35N2Si/c1-22-18-23(2)24(3)29(19-22)34-28-17-16-25(37(5,6)7)20-30(28)33(21-35(34)4)36-31-14-10-8-12-26(31)27-13-9-11-15-32(27)36/h8-21H,1-7H3/q+1 |
| InChIKey | GTKQPXBMXHWVKU-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.75 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|